C18H22N4O — CID 118938285
N-(6-cyano-1-cyclobutylbenzimidazol-2-yl)-3,3-dimethylbutanamide (PubChem CID 118938285) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(6-cyano-1-cyclobutylbenzimidazol-2-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(6-cyano-1-cyclobutylbenzimidazol-2-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 118938285 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-(6-cyano-1-cyclobutylbenzimidazol-2-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1nc2ccc(C#N)cc2n1C1CCC1 |
| InChI | InChI=1S/C18H22N4O/c1-18(2,3)10-16(23)21-17-20-14-8-7-12(11-19)9-15(14)22(17)13-5-4-6-13/h7-9,13H,4-6,10H2,1-3H3,(H,20,21,23) |
| InChIKey | DUIOJOJPBIMFPY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |