C18H25N3O — CID 118941483
N-(1-cyclobutyl-6-methylbenzimidazol-2-yl)-3,3-dimethylbutanamide (PubChem CID 118941483) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(1-cyclobutyl-6-methylbenzimidazol-2-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(1-cyclobutyl-6-methylbenzimidazol-2-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 118941483 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(1-cyclobutyl-6-methylbenzimidazol-2-yl)-3,3-dimethylbutanamide |
| SMILES | Cc1ccc2nc(NC(=O)CC(C)(C)C)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C18H25N3O/c1-12-8-9-14-15(10-12)21(13-6-5-7-13)17(19-14)20-16(22)11-18(2,3)4/h8-10,13H,5-7,11H2,1-4H3,(H,19,20,22) |
| InChIKey | NWEYHHQRLFUAEL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |