C27H31F3N2O3 — CID 139518576
8-[1-cyclobutyl-5-methoxy-6-(trifluoromethyl)benzimidazol-2-yl]-2-hydroxy-2-phenyloctan-4-one (PubChem CID 139518576) has the molecular formula C27H31F3N2O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is 8-[1-cyclobutyl-5-methoxy-6-(trifluoromethyl)benzimidazol-2-yl]-2-hydroxy-2-phenyloctan-4-one.
| Compound Name | 8-[1-cyclobutyl-5-methoxy-6-(trifluoromethyl)benzimidazol-2-yl]-2-hydroxy-2-phenyloctan-4-one |
|---|---|
| PubChem CID | 139518576 |
| Molecular Formula | C27H31F3N2O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 8-[1-cyclobutyl-5-methoxy-6-(trifluoromethyl)benzimidazol-2-yl]-2-hydroxy-2-phenyloctan-4-one |
| SMILES | COc1cc2nc(CCCCC(=O)CC(C)(O)c3ccccc3)n(C3CCC3)c2cc1C(F)(F)F |
| InChI | InChI=1S/C27H31F3N2O3/c1-26(34,18-9-4-3-5-10-18)17-20(33)13-6-7-14-25-31-22-16-24(35-2)21(27(28,29)30)15-23(22)32(25)19-11-8-12-19/h3-5,9-10,15-16,19,34H,6-8,11-14,17H2,1-2H3 |
| InChIKey | GGNJBYPXMOBVMB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|