C18H15F2N5O2S — CID 118692846
15,15-difluoro-8-[(4-methoxyphenyl)methyl]-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one (PubChem CID 118692846) has the molecular formula C18H15F2N5O2S and a molecular weight of 403.41 g/mol. Its IUPAC name is 15,15-difluoro-8-[(4-methoxyphenyl)methyl]-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one.
| Compound Name | 15,15-difluoro-8-[(4-methoxyphenyl)methyl]-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
|---|---|
| PubChem CID | 118692846 |
| Molecular Formula | C18H15F2N5O2S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 15,15-difluoro-8-[(4-methoxyphenyl)methyl]-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
| SMILES | COc1ccc(Cn2c(=O)n3ncnc3c3c4c(sc32)CNCC4(F)F)cc1 |
| InChI | InChI=1S/C18H15F2N5O2S/c1-27-11-4-2-10(3-5-11)7-24-16-13(15-22-9-23-25(15)17(24)26)14-12(28-16)6-21-8-18(14,19)20/h2-5,9,21H,6-8H2,1H3 |
| InChIKey | ONYFFKRZGFBNJU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |