C25H21N5O2S — CID 118692820
11-(isoindol-2-ylmethyl)-8-[(4-methoxyphenyl)methyl]-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 118692820) has the molecular formula C25H21N5O2S and a molecular weight of 455.54 g/mol. Its IUPAC name is 11-(isoindol-2-ylmethyl)-8-[(4-methoxyphenyl)methyl]-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 11-(isoindol-2-ylmethyl)-8-[(4-methoxyphenyl)methyl]-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 118692820 |
| Molecular Formula | C25H21N5O2S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 11-(isoindol-2-ylmethyl)-8-[(4-methoxyphenyl)methyl]-12-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | COc1ccc(Cn2c(=O)n3ncnc3c3c(C)c(Cn4cc5ccccc5c4)sc32)cc1 |
| InChI | InChI=1S/C25H21N5O2S/c1-16-21(14-28-12-18-5-3-4-6-19(18)13-28)33-24-22(16)23-26-15-27-30(23)25(31)29(24)11-17-7-9-20(32-2)10-8-17/h3-10,12-13,15H,11,14H2,1-2H3 |
| InChIKey | QHJHZDCOQIGTGL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |