C13H12O3S — CID 118703104
2-(4-methoxy-3-thiophen-2-ylphenyl)acetic acid (PubChem CID 118703104) has the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-(4-methoxy-3-thiophen-2-ylphenyl)acetic acid.
| Compound Name | 2-(4-methoxy-3-thiophen-2-ylphenyl)acetic acid |
|---|---|
| PubChem CID | 118703104 |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(4-methoxy-3-thiophen-2-ylphenyl)acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1-c1cccs1 |
| InChI | InChI=1S/C13H12O3S/c1-16-11-5-4-9(8-13(14)15)7-10(11)12-3-2-6-17-12/h2-7H,8H2,1H3,(H,14,15) |
| InChIKey | HCAVDRSGOUZCSD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |