C20H18O3S — CID 23159951
3-[4-[(3-thiophen-2-ylphenyl)methoxy]phenyl]propanoic acid (PubChem CID 23159951) has the molecular formula C20H18O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-[4-[(3-thiophen-2-ylphenyl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[(3-thiophen-2-ylphenyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23159951 |
| Molecular Formula | C20H18O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-[4-[(3-thiophen-2-ylphenyl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCc2cccc(-c3cccs3)c2)cc1 |
| InChI | InChI=1S/C20H18O3S/c21-20(22)11-8-15-6-9-18(10-7-15)23-14-16-3-1-4-17(13-16)19-5-2-12-24-19/h1-7,9-10,12-13H,8,11,14H2,(H,21,22) |
| InChIKey | SHFHKOOKUXCPPE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |