C7H2Br2F5NO — CID 118704019
2,4-dibromo-3-(difluoromethoxy)-6-(trifluoromethyl)pyridine (PubChem CID 118704019) has the molecular formula C7H2Br2F5NO and a molecular weight of 370.90 g/mol. Its IUPAC name is 2,4-dibromo-3-(difluoromethoxy)-6-(trifluoromethyl)pyridine.
| Compound Name | 2,4-dibromo-3-(difluoromethoxy)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 118704019 |
| Molecular Formula | C7H2Br2F5NO |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 368.84 |
| IUPAC Name | 2,4-dibromo-3-(difluoromethoxy)-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)Oc1c(Br)cc(C(F)(F)F)nc1Br |
| InChI | InChI=1S/C7H2Br2F5NO/c8-2-1-3(7(12,13)14)15-5(9)4(2)16-6(10)11/h1,6H |
| InChIKey | XVHHIJBOWKOSPC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|