C24H29N3O2 — CID 11870525
(1S,2R,5S,6S,9S,10S,13S)-6-hydroxy-1,5-dimethyl-17-oxo-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),18-diene-18,19-dicarbonitrile (PubChem CID 11870525) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (1S,2R,5S,6S,9S,10S,13S)-6-hydroxy-1,5-dimethyl-17-oxo-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),18-diene-18,19-dicarbonitrile.
| Compound Name | (1S,2R,5S,6S,9S,10S,13S)-6-hydroxy-1,5-dimethyl-17-oxo-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),18-diene-18,19-dicarbonitrile |
|---|---|
| PubChem CID | 11870525 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (1S,2R,5S,6S,9S,10S,13S)-6-hydroxy-1,5-dimethyl-17-oxo-16-azapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-15(20),18-diene-18,19-dicarbonitrile |
| SMILES | C[C@]12Cc3c([nH]c(=O)c(C#N)c3C#N)C[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C24H29N3O2/c1-23-8-7-19-14(18(23)5-6-21(23)28)4-3-13-9-20-15(10-24(13,19)2)16(11-25)17(12-26)22(29)27-20/h13-14,18-19,21,28H,3-10H2,1-2H3,(H,27,29)/t13-,14+,18-,19+,21-,23-,24-/m0/s1 |
| InChIKey | RONRYQJFHZPPMI-ZANJPIGKSA-N |
| XLogP | 3.44 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |