C28H22N4O2 — CID 118707839
(E)-N-(2-aminophenyl)-3-[4-[5-(naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]prop-2-enamide (PubChem CID 118707839) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[5-(naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[5-(naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118707839 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[5-(naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(-c2nnc(Cc3ccc4ccccc4c3)o2)cc1 |
| InChI | InChI=1S/C28H22N4O2/c29-24-7-3-4-8-25(24)30-26(33)16-12-19-9-14-22(15-10-19)28-32-31-27(34-28)18-20-11-13-21-5-1-2-6-23(21)17-20/h1-17H,18,29H2,(H,30,33)/b16-12+ |
| InChIKey | MBVDRTDKRGVQLM-FOWTUZBSSA-N |
| XLogP | 5.71 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|