C20H18ClNO4 — CID 118708621
[1-(4-chlorophenyl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 118708621) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is [1-(4-chlorophenyl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [1-(4-chlorophenyl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 118708621 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [1-(4-chlorophenyl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2ccn(-c3ccc(Cl)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H18ClNO4/c1-24-17-10-14(11-18(25-2)20(17)26-3)19(23)13-8-9-22(12-13)16-6-4-15(21)5-7-16/h4-12H,1-3H3 |
| InChIKey | CCAVMIQQQISYAK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |