C21H20BNO6 — CID 90676661
[1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 90676661) has the molecular formula C21H20BNO6 and a molecular weight of 393.20 g/mol. Its IUPAC name is [1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 90676661 |
| Molecular Formula | C21H20BNO6 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrol-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2ccn(-c3ccc4c(c3)B(O)OC4)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20BNO6/c1-26-18-8-15(9-19(27-2)21(18)28-3)20(24)13-6-7-23(11-13)16-5-4-14-12-29-22(25)17(14)10-16/h4-11,25H,12H2,1-3H3 |
| InChIKey | VAIXYTHIPWSHBZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|