C29H22IN3O7 — CID 118709488
6-hydroxy-2-[3-[[2-[2-[5-(hydroxymethyl)furan-2-yl]anilino]-2-oxoacetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid (PubChem CID 118709488) has the molecular formula C29H22IN3O7 and a molecular weight of 651.41 g/mol. Its IUPAC name is 6-hydroxy-2-[3-[[2-[2-[5-(hydroxymethyl)furan-2-yl]anilino]-2-oxoacetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid.
| Compound Name | 6-hydroxy-2-[3-[[2-[2-[5-(hydroxymethyl)furan-2-yl]anilino]-2-oxoacetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 118709488 |
| Molecular Formula | C29H22IN3O7 |
| Molecular Weight | 651.41 g/mol |
| Exact Mass | 651.05 |
| IUPAC Name | 6-hydroxy-2-[3-[[2-[2-[5-(hydroxymethyl)furan-2-yl]anilino]-2-oxoacetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid |
| SMILES | Cn1c(-c2cccc(NC(=O)C(=O)Nc3ccccc3-c3ccc(CO)o3)c2)c(I)c2cc(C(=O)O)c(O)cc21 |
| InChI | InChI=1S/C29H22IN3O7/c1-33-22-13-23(35)20(29(38)39)12-19(22)25(30)26(33)15-5-4-6-16(11-15)31-27(36)28(37)32-21-8-3-2-7-18(21)24-10-9-17(14-34)40-24/h2-13,34-35H,14H2,1H3,(H,31,36)(H,32,37)(H,38,39) |
| InChIKey | ZIIMUYFKCXJFPR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|