C31H24IN3O6 — CID 86764773
6-hydroxy-3-iodo-1-methyl-2-[3-[[2-oxo-2-(3-phenylmethoxyanilino)acetyl]amino]phenyl]indole-5-carboxylic acid (PubChem CID 86764773) has the molecular formula C31H24IN3O6 and a molecular weight of 661.45 g/mol. Its IUPAC name is 6-hydroxy-3-iodo-1-methyl-2-[3-[[2-oxo-2-(3-phenylmethoxyanilino)acetyl]amino]phenyl]indole-5-carboxylic acid.
| Compound Name | 6-hydroxy-3-iodo-1-methyl-2-[3-[[2-oxo-2-(3-phenylmethoxyanilino)acetyl]amino]phenyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 86764773 |
| Molecular Formula | C31H24IN3O6 |
| Molecular Weight | 661.45 g/mol |
| Exact Mass | 661.07 |
| IUPAC Name | 6-hydroxy-3-iodo-1-methyl-2-[3-[[2-oxo-2-(3-phenylmethoxyanilino)acetyl]amino]phenyl]indole-5-carboxylic acid |
| SMILES | Cn1c(-c2cccc(NC(=O)C(=O)Nc3cccc(OCc4ccccc4)c3)c2)c(I)c2cc(C(=O)O)c(O)cc21 |
| InChI | InChI=1S/C31H24IN3O6/c1-35-25-16-26(36)24(31(39)40)15-23(25)27(32)28(35)19-9-5-10-20(13-19)33-29(37)30(38)34-21-11-6-12-22(14-21)41-17-18-7-3-2-4-8-18/h2-16,36H,17H2,1H3,(H,33,37)(H,34,38)(H,39,40) |
| InChIKey | CPGHULPHYSDBNR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|