C14H9ClN4 — CID 118711124
10-chloro-3H-pyrazolo[4,5-a]phenanthridin-5-amine (PubChem CID 118711124) has the molecular formula C14H9ClN4 and a molecular weight of 268.71 g/mol. Its IUPAC name is 10-chloro-3H-pyrazolo[4,5-a]phenanthridin-5-amine.
| Compound Name | 10-chloro-3H-pyrazolo[4,5-a]phenanthridin-5-amine |
|---|---|
| PubChem CID | 118711124 |
| Molecular Formula | C14H9ClN4 |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 10-chloro-3H-pyrazolo[4,5-a]phenanthridin-5-amine |
| SMILES | Nc1cc2[nH]ncc2c2c1ncc1ccc(Cl)cc12 |
| InChI | InChI=1S/C14H9ClN4/c15-8-2-1-7-5-17-14-11(16)4-12-10(6-18-19-12)13(14)9(7)3-8/h1-6H,16H2,(H,18,19) |
| InChIKey | WEOQQWMMYSFSHR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|