C14H18N4O2S — CID 118711612
4-(4-cyclohexyltriazol-1-yl)benzenesulfonamide (PubChem CID 118711612) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-(4-cyclohexyltriazol-1-yl)benzenesulfonamide.
| Compound Name | 4-(4-cyclohexyltriazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118711612 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-(4-cyclohexyltriazol-1-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(C3CCCCC3)nn2)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c15-21(19,20)13-8-6-12(7-9-13)18-10-14(16-17-18)11-4-2-1-3-5-11/h6-11H,1-5H2,(H2,15,19,20) |
| InChIKey | OJVPQOFLERGSTQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |