C14H14F4N4O2S — CID 53389268
4-(4-cyclohexyltriazol-1-yl)-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 53389268) has the molecular formula C14H14F4N4O2S and a molecular weight of 378.35 g/mol. Its IUPAC name is 4-(4-cyclohexyltriazol-1-yl)-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-(4-cyclohexyltriazol-1-yl)-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 53389268 |
| Molecular Formula | C14H14F4N4O2S |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-(4-cyclohexyltriazol-1-yl)-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(-n2cc(C3CCCCC3)nn2)c(F)c1F |
| InChI | InChI=1S/C14H14F4N4O2S/c15-9-11(17)14(25(19,23)24)12(18)10(16)13(9)22-6-8(20-21-22)7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,19,23,24) |
| InChIKey | RAGBVAFIIJNDRZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|