C14H19NO3 — CID 118712104
2-[(2S,4R,5R,6R)-4-hydroxy-5-methyl-6-phenylpiperidin-2-yl]acetic acid (PubChem CID 118712104) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[(2S,4R,5R,6R)-4-hydroxy-5-methyl-6-phenylpiperidin-2-yl]acetic acid.
| Compound Name | 2-[(2S,4R,5R,6R)-4-hydroxy-5-methyl-6-phenylpiperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 118712104 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-[(2S,4R,5R,6R)-4-hydroxy-5-methyl-6-phenylpiperidin-2-yl]acetic acid |
| SMILES | C[C@H]1[C@H](O)C[C@@H](CC(=O)O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-9-12(16)7-11(8-13(17)18)15-14(9)10-5-3-2-4-6-10/h2-6,9,11-12,14-16H,7-8H2,1H3,(H,17,18)/t9-,11-,12+,14+/m0/s1 |
| InChIKey | KVJBVDKAQRTPOK-PQFRYHKHSA-N |
| XLogP | 1.56 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |