C21H29N3O3 — CID 118713502
5,6-Dimethyl-1-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-2,4-dione (PubChem CID 118713502) has the molecular formula C21H29N3O3 and a molecular weight of 371.50 g/mol. Its IUPAC name is 5,6-dimethyl-1-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-2,4-dione.
| Compound Name | 5,6-Dimethyl-1-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118713502 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 5,6-dimethyl-1-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]pyrimidine-2,4-dione |
| SMILES | CC1=C(N(C(=O)NC1=O)CC2=CC=C(C=C2)OCCCN3CCCCC3)C |
| InChI | InChI=1S/C21H29N3O3/c1-16-17(2)24(21(26)22-20(16)25)15-18-7-9-19(10-8-18)27-14-6-13-23-11-4-3-5-12-23/h7-10H,3-6,11-15H2,1-2H3,(H,22,25,26) |
| InChIKey | RYLAQALHOUHXOC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | 561 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|