C15H12N2O3 — CID 23625830
2-(4-methoxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione (PubChem CID 23625830) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione.
| Compound Name | 2-(4-methoxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 23625830 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-1H-pyrido[1,2-a]pyrimidine-4,6-dione |
| SMILES | COc1ccc(-c2cc(=O)n3c(=O)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C15H12N2O3/c1-20-11-7-5-10(6-8-11)12-9-15(19)17-13(16-12)3-2-4-14(17)18/h2-9,16H,1H3 |
| InChIKey | VNJHTYQWRHCOIM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |