C21H20FN3O — CID 118714238
N'-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide (PubChem CID 118714238) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is N'-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide.
| Compound Name | N'-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide |
|---|---|
| PubChem CID | 118714238 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N'-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-hydroxy-3-naphthalen-1-ylpropanimidamide |
| SMILES | C/C(=N\N=C(/N)CC(O)c1cccc2ccccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3O/c1-14(15-9-11-17(22)12-10-15)24-25-21(23)13-20(26)19-8-4-6-16-5-2-3-7-18(16)19/h2-12,20,26H,13H2,1H3,(H2,23,25)/b24-14+ |
| InChIKey | XUZOMUJAJBNFLX-ZVHZXABRSA-N |
| XLogP | 4.18 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|