C21H21N3O2 — CID 118714241
3-hydroxy-N'-[(E)-(4-methoxyphenyl)methylideneamino]-3-naphthalen-2-ylpropanimidamide (PubChem CID 118714241) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-hydroxy-N'-[(E)-(4-methoxyphenyl)methylideneamino]-3-naphthalen-2-ylpropanimidamide.
| Compound Name | 3-hydroxy-N'-[(E)-(4-methoxyphenyl)methylideneamino]-3-naphthalen-2-ylpropanimidamide |
|---|---|
| PubChem CID | 118714241 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-hydroxy-N'-[(E)-(4-methoxyphenyl)methylideneamino]-3-naphthalen-2-ylpropanimidamide |
| SMILES | COc1ccc(/C=N/N=C(\N)CC(O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-26-19-10-6-15(7-11-19)14-23-24-21(22)13-20(25)18-9-8-16-4-2-3-5-17(16)12-18/h2-12,14,20,25H,13H2,1H3,(H2,22,24)/b23-14+ |
| InChIKey | CDEVMVARDBMHPM-OEAKJJBVSA-N |
| XLogP | 3.66 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|