C21H25N3O — CID 118714742
1-butyl-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile (PubChem CID 118714742) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-butyl-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 1-butyl-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118714742 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-butyl-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile |
| SMILES | CCCCn1ccc(N2CCC(c3ccccc3)CC2)c(C#N)c1=O |
| InChI | InChI=1S/C21H25N3O/c1-2-3-12-24-15-11-20(19(16-22)21(24)25)23-13-9-18(10-14-23)17-7-5-4-6-8-17/h4-8,11,15,18H,2-3,9-10,12-14H2,1H3 |
| InChIKey | GSVFLIVBVQPBLW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |