C21H23N3O — CID 59234231
1-(cyclopropylmethyl)-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile (PubChem CID 59234231) has the molecular formula C21H23N3O and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 1-(cyclopropylmethyl)-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59234231 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-oxo-4-(4-phenylpiperidin-1-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N2CCC(c3ccccc3)CC2)ccn(CC2CC2)c1=O |
| InChI | InChI=1S/C21H23N3O/c22-14-19-20(10-13-24(21(19)25)15-16-6-7-16)23-11-8-18(9-12-23)17-4-2-1-3-5-17/h1-5,10,13,16,18H,6-9,11-12,15H2 |
| InChIKey | RVRHQHDKALSKLY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |