C22H28O12 — CID 118715425
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(3S,4R,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate (PubChem CID 118715425) has the molecular formula C22H28O12 and a molecular weight of 484.45 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(3S,4R,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(3S,4R,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118715425 |
| Molecular Formula | C22H28O12 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(3S,4R,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate |
| SMILES | C=C[C@H]1[C@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](O)[C@H](OC(C)=O)[C@H]2OC(C)=O)OC=C2C(=O)OCC[C@H]21 |
| InChI | InChI=1S/C22H28O12/c1-5-13-14-6-7-28-20(27)15(14)8-30-21(13)34-22-19(32-12(4)25)18(31-11(3)24)17(26)16(33-22)9-29-10(2)23/h5,8,13-14,16-19,21-22,26H,1,6-7,9H2,2-4H3/t13-,14+,16-,17-,18+,19-,21+,22+/m1/s1 |
| InChIKey | PDOGRHLUXBLKAT-FGFQXQBLSA-N |
| XLogP | 0.12 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|