C22H20N4S — CID 118715531
1-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-phenylthiourea (PubChem CID 118715531) has the molecular formula C22H20N4S and a molecular weight of 372.50 g/mol. Its IUPAC name is 1-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-phenylthiourea.
| Compound Name | 1-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 118715531 |
| Molecular Formula | C22H20N4S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[(1R)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]-3-phenylthiourea |
| SMILES | S=C(Nc1ccccc1)N[C@H](Cc1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H20N4S/c27-22(23-17-11-5-2-6-12-17)26-20(15-16-9-3-1-4-10-16)21-24-18-13-7-8-14-19(18)25-21/h1-14,20H,15H2,(H,24,25)(H2,23,26,27)/t20-/m1/s1 |
| InChIKey | WNXNJWKZYPSLCX-HXUWFJFHSA-N |
| XLogP | 4.83 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|