C25H22FN5O3S2 — CID 58746822
1-[(1S)-1-(1H-benzimidazol-2-yl)-2-[3-fluoro-4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-phenylthiourea (PubChem CID 58746822) has the molecular formula C25H22FN5O3S2 and a molecular weight of 523.62 g/mol. Its IUPAC name is 1-[(1S)-1-(1H-benzimidazol-2-yl)-2-[3-fluoro-4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-phenylthiourea.
| Compound Name | 1-[(1S)-1-(1H-benzimidazol-2-yl)-2-[3-fluoro-4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 58746822 |
| Molecular Formula | C25H22FN5O3S2 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 1-[(1S)-1-(1H-benzimidazol-2-yl)-2-[3-fluoro-4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-phenylthiourea |
| SMILES | O=C1CC(c2ccc(C[C@H](NC(=S)Nc3ccccc3)c3nc4ccccc4[nH]3)cc2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C25H22FN5O3S2/c26-18-12-15(10-11-17(18)22-14-23(32)31-36(22,33)34)13-21(24-28-19-8-4-5-9-20(19)29-24)30-25(35)27-16-6-2-1-3-7-16/h1-12,21-22H,13-14H2,(H,28,29)(H,31,32)(H2,27,30,35)/t21-,22?/m0/s1 |
| InChIKey | MXHQQMBHCDECTB-HMTLIYDFSA-N |
| XLogP | 3.86 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|