C26H20N6O3S2 — CID 58746735
5-[4-[(2S)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-ylamino)ethyl]-2-isocyanophenyl]-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 58746735) has the molecular formula C26H20N6O3S2 and a molecular weight of 528.62 g/mol. Its IUPAC name is 5-[4-[(2S)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-ylamino)ethyl]-2-isocyanophenyl]-1,1-dioxo-1,2-thiazolidin-3-one.
| Compound Name | 5-[4-[(2S)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-ylamino)ethyl]-2-isocyanophenyl]-1,1-dioxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 58746735 |
| Molecular Formula | C26H20N6O3S2 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 5-[4-[(2S)-2-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-2-ylamino)ethyl]-2-isocyanophenyl]-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | [C-]#[N+]c1cc(C[C@H](Nc2nc3ccccc3s2)c2nc3ccccc3[nH]2)ccc1C1CC(=O)NS1(=O)=O |
| InChI | InChI=1S/C26H20N6O3S2/c1-27-20-12-15(10-11-16(20)23-14-24(33)32-37(23,34)35)13-21(25-28-17-6-2-3-7-18(17)29-25)31-26-30-19-8-4-5-9-22(19)36-26/h2-12,21,23H,13-14H2,(H,28,29)(H,30,31)(H,32,33)/t21-,23?/m0/s1 |
| InChIKey | IRRCJLNKPCAROF-BBQAJUCSSA-N |
| XLogP | 5.01 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|