C22H29N4O5P — CID 118716185
[2-amino-2-(hydroxymethyl)-4-[4-[1-(4-propylphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate (PubChem CID 118716185) has the molecular formula C22H29N4O5P and a molecular weight of 460.47 g/mol. Its IUPAC name is [2-amino-2-(hydroxymethyl)-4-[4-[1-(4-propylphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-(hydroxymethyl)-4-[4-[1-(4-propylphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716185 |
| Molecular Formula | C22H29N4O5P |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [2-amino-2-(hydroxymethyl)-4-[4-[1-(4-propylphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate |
| SMILES | CCCc1ccc(-n2cc(-c3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)nn2)cc1 |
| InChI | InChI=1S/C22H29N4O5P/c1-2-3-17-6-10-20(11-7-17)26-14-21(24-25-26)19-8-4-18(5-9-19)12-13-22(23,15-27)16-31-32(28,29)30/h4-11,14,27H,2-3,12-13,15-16,23H2,1H3,(H2,28,29,30) |
| InChIKey | UDQCMJUUIKMMLA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|