C20H25N4O6P — CID 118716178
[2-amino-2-(hydroxymethyl)-4-[4-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate (PubChem CID 118716178) has the molecular formula C20H25N4O6P and a molecular weight of 448.42 g/mol. Its IUPAC name is [2-amino-2-(hydroxymethyl)-4-[4-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-(hydroxymethyl)-4-[4-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716178 |
| Molecular Formula | C20H25N4O6P |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [2-amino-2-(hydroxymethyl)-4-[4-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]butyl] dihydrogen phosphate |
| SMILES | COc1ccc(-n2cc(-c3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)nn2)cc1 |
| InChI | InChI=1S/C20H25N4O6P/c1-29-18-8-6-17(7-9-18)24-12-19(22-23-24)16-4-2-15(3-5-16)10-11-20(21,13-25)14-30-31(26,27)28/h2-9,12,25H,10-11,13-14,21H2,1H3,(H2,26,27,28) |
| InChIKey | HIPMVXCPWYYOGF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|