C22H28N4O4 — CID 16736229
2-[2-[2-[4-[4-[4-(dimethylamino)phenyl]triazol-1-yl]phenoxy]ethoxy]ethoxy]ethanol (PubChem CID 16736229) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[2-[2-[4-[4-[4-(dimethylamino)phenyl]triazol-1-yl]phenoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[4-[4-[4-(dimethylamino)phenyl]triazol-1-yl]phenoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 16736229 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[2-[2-[4-[4-[4-(dimethylamino)phenyl]triazol-1-yl]phenoxy]ethoxy]ethoxy]ethanol |
| SMILES | CN(C)c1ccc(-c2cn(-c3ccc(OCCOCCOCCO)cc3)nn2)cc1 |
| InChI | InChI=1S/C22H28N4O4/c1-25(2)19-5-3-18(4-6-19)22-17-26(24-23-22)20-7-9-21(10-8-20)30-16-15-29-14-13-28-12-11-27/h3-10,17,27H,11-16H2,1-2H3 |
| InChIKey | RHSZYIDPTHMWBF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|