C19H21FN4O — CID 16736237
4-[1-[4-(3-fluoropropoxy)phenyl]triazol-4-yl]-N,N-dimethylaniline (PubChem CID 16736237) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[1-[4-(3-fluoropropoxy)phenyl]triazol-4-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1-[4-(3-fluoropropoxy)phenyl]triazol-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 16736237 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-[1-[4-(3-fluoropropoxy)phenyl]triazol-4-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cn(-c3ccc(OCCCF)cc3)nn2)cc1 |
| InChI | InChI=1S/C19H21FN4O/c1-23(2)16-6-4-15(5-7-16)19-14-24(22-21-19)17-8-10-18(11-9-17)25-13-3-12-20/h4-11,14H,3,12-13H2,1-2H3 |
| InChIKey | WACVKHAXTKMTHO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|