C23H29N5O2 — CID 122180620
1-[4-(2-methoxyphenyl)piperazin-1-yl]-4-(4-phenyltriazol-1-yl)butan-2-ol (PubChem CID 122180620) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)piperazin-1-yl]-4-(4-phenyltriazol-1-yl)butan-2-ol.
| Compound Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-4-(4-phenyltriazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 122180620 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-4-(4-phenyltriazol-1-yl)butan-2-ol |
| SMILES | COc1ccccc1N1CCN(CC(O)CCn2cc(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C23H29N5O2/c1-30-23-10-6-5-9-22(23)27-15-13-26(14-16-27)17-20(29)11-12-28-18-21(24-25-28)19-7-3-2-4-8-19/h2-10,18,20,29H,11-17H2,1H3 |
| InChIKey | KOKVPXWLCVIJPN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |