C15H9NO2S — CID 118717513
10-hydroxy-5H-[1]benzothiolo[2,3-c]quinolin-6-one (PubChem CID 118717513) has the molecular formula C15H9NO2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 10-hydroxy-5H-[1]benzothiolo[2,3-c]quinolin-6-one.
| Compound Name | 10-hydroxy-5H-[1]benzothiolo[2,3-c]quinolin-6-one |
|---|---|
| PubChem CID | 118717513 |
| Molecular Formula | C15H9NO2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 10-hydroxy-5H-[1]benzothiolo[2,3-c]quinolin-6-one |
| SMILES | O=c1[nH]c2ccccc2c2c1sc1ccc(O)cc12 |
| InChI | InChI=1S/C15H9NO2S/c17-8-5-6-12-10(7-8)13-9-3-1-2-4-11(9)16-15(18)14(13)19-12/h1-7,17H,(H,16,18) |
| InChIKey | OUOFJCNBZFOSCL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |