C15H11NO3S — CID 164618683
5,6-dihydroxy-N-phenyl-1-benzothiophene-2-carboxamide (PubChem CID 164618683) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is 5,6-dihydroxy-N-phenyl-1-benzothiophene-2-carboxamide.
| Compound Name | 5,6-dihydroxy-N-phenyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 164618683 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 5,6-dihydroxy-N-phenyl-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc2cc(O)c(O)cc2s1 |
| InChI | InChI=1S/C15H11NO3S/c17-11-6-9-7-14(20-13(9)8-12(11)18)15(19)16-10-4-2-1-3-5-10/h1-8,17-18H,(H,16,19) |
| InChIKey | YFQBRKWSZNOTIX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|