C20H15NO4S — CID 53319502
N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide (PubChem CID 53319502) has the molecular formula C20H15NO4S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53319502 |
| Molecular Formula | C20H15NO4S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H15NO4S/c22-16(9-3-13-4-10-17(23)18(24)12-13)14-5-7-15(8-6-14)21-20(25)19-2-1-11-26-19/h1-12,23-24H,(H,21,25)/b9-3+ |
| InChIKey | KTYCHNSVRLNOTQ-YCRREMRBSA-N |
| XLogP | 4.31 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|