C18H14N2O3S — CID 880338
N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 880338) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 880338 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[4-[(4-hydroxyphenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H14N2O3S/c21-15-9-7-14(8-10-15)19-17(22)12-3-5-13(6-4-12)20-18(23)16-2-1-11-24-16/h1-11,21H,(H,19,22)(H,20,23) |
| InChIKey | VGNBTOMRNPGGLG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|