C12H9NO4S — CID 893990
5-hydroxy-2-(thiophene-2-carbonylamino)benzoic acid (PubChem CID 893990) has the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. Its IUPAC name is 5-hydroxy-2-(thiophene-2-carbonylamino)benzoic acid.
| Compound Name | 5-hydroxy-2-(thiophene-2-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 893990 |
| Molecular Formula | C12H9NO4S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 5-hydroxy-2-(thiophene-2-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(O)cc1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H9NO4S/c14-7-3-4-9(8(6-7)12(16)17)13-11(15)10-2-1-5-18-10/h1-6,14H,(H,13,15)(H,16,17) |
| InChIKey | DVPYPJCHKZKOJU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_acid_F(2)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|