C20H18N2O4S — CID 164616638
(2S)-1-(5,6-dihydroxy-1-benzothiophene-2-carbonyl)-N-phenylpyrrolidine-2-carboxamide (PubChem CID 164616638) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is (2S)-1-(5,6-dihydroxy-1-benzothiophene-2-carbonyl)-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(5,6-dihydroxy-1-benzothiophene-2-carbonyl)-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 164616638 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2S)-1-(5,6-dihydroxy-1-benzothiophene-2-carbonyl)-N-phenylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1CCCN1C(=O)c1cc2cc(O)c(O)cc2s1 |
| InChI | InChI=1S/C20H18N2O4S/c23-15-9-12-10-18(27-17(12)11-16(15)24)20(26)22-8-4-7-14(22)19(25)21-13-5-2-1-3-6-13/h1-3,5-6,9-11,14,23-24H,4,7-8H2,(H,21,25)/t14-/m0/s1 |
| InChIKey | YQWYZZLAJOUUEK-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|