C22H23FN2O4 — CID 118717718
4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]chromen-2-one (PubChem CID 118717718) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]chromen-2-one.
| Compound Name | 4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]chromen-2-one |
|---|---|
| PubChem CID | 118717718 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-[3-[4-(2-fluorophenyl)piperazin-1-yl]-2-hydroxypropoxy]chromen-2-one |
| SMILES | O=c1cc(OCC(O)CN2CCN(c3ccccc3F)CC2)c2ccccc2o1 |
| InChI | InChI=1S/C22H23FN2O4/c23-18-6-2-3-7-19(18)25-11-9-24(10-12-25)14-16(26)15-28-21-13-22(27)29-20-8-4-1-5-17(20)21/h1-8,13,16,26H,9-12,14-15H2 |
| InChIKey | IULKBIKCJMRMDW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|