C27H28N2O5 — CID 122216516
4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]xanthen-9-one (PubChem CID 122216516) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]xanthen-9-one.
| Compound Name | 4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]xanthen-9-one |
|---|---|
| PubChem CID | 122216516 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-[(2R)-2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]xanthen-9-one |
| SMILES | COc1ccccc1N1CCN(C[C@@H](O)COc2cccc3c(=O)c4ccccc4oc23)CC1 |
| InChI | InChI=1S/C27H28N2O5/c1-32-24-11-5-3-9-22(24)29-15-13-28(14-16-29)17-19(30)18-33-25-12-6-8-21-26(31)20-7-2-4-10-23(20)34-27(21)25/h2-12,19,30H,13-18H2,1H3/t19-/m1/s1 |
| InChIKey | AJCWIIIWBDEVGZ-LJQANCHMSA-N |
| XLogP | 3.52 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|