C23H27N3O6 — CID 70382764
7-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-3-oxo-1-benzofuran-2-carboxamide (PubChem CID 70382764) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 7-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-3-oxo-1-benzofuran-2-carboxamide.
| Compound Name | 7-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-3-oxo-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 70382764 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 7-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-3-oxo-1-benzofuran-2-carboxamide |
| SMILES | COc1ccccc1N1CCN(CC(O)COc2cccc3c2OC(C(N)=O)C3=O)CC1 |
| InChI | InChI=1S/C23H27N3O6/c1-30-18-7-3-2-6-17(18)26-11-9-25(10-12-26)13-15(27)14-31-19-8-4-5-16-20(28)22(23(24)29)32-21(16)19/h2-8,15,22,27H,9-14H2,1H3,(H2,24,29) |
| InChIKey | HWSALFFGFYRLTA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|