C28H28N2O6 — CID 24795155
4-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-hydroxypropoxy]xanthen-9-one (PubChem CID 24795155) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 4-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-hydroxypropoxy]xanthen-9-one.
| Compound Name | 4-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-hydroxypropoxy]xanthen-9-one |
|---|---|
| PubChem CID | 24795155 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 4-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-hydroxypropoxy]xanthen-9-one |
| SMILES | O=c1c2ccccc2oc2c(OCC(O)CN3CCN(Cc4ccc5c(c4)OCO5)CC3)cccc12 |
| InChI | InChI=1S/C28H28N2O6/c31-20(16-30-12-10-29(11-13-30)15-19-8-9-24-26(14-19)35-18-34-24)17-33-25-7-3-5-22-27(32)21-4-1-2-6-23(21)36-28(22)25/h1-9,14,20,31H,10-13,15-18H2 |
| InChIKey | YZXHQBYQHWMVHG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|