C21H16N4O4 — CID 118719131
(NE,3Z)-N-[(3-nitrophenyl)methylidene]-1-phenacylpyridin-1-ium-3-carbohydrazonate (PubChem CID 118719131) has the molecular formula C21H16N4O4 and a molecular weight of 388.38 g/mol. Its IUPAC name is (NE,3Z)-N-[(3-nitrophenyl)methylidene]-1-phenacylpyridin-1-ium-3-carbohydrazonate.
| Compound Name | (NE,3Z)-N-[(3-nitrophenyl)methylidene]-1-phenacylpyridin-1-ium-3-carbohydrazonate |
|---|---|
| PubChem CID | 118719131 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (NE,3Z)-N-[(3-nitrophenyl)methylidene]-1-phenacylpyridin-1-ium-3-carbohydrazonate |
| SMILES | O=C(C[n+]1cccc(/C([O-])=N/N=C/c2cccc([N+](=O)[O-])c2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H16N4O4/c26-20(17-7-2-1-3-8-17)15-24-11-5-9-18(14-24)21(27)23-22-13-16-6-4-10-19(12-16)25(28)29/h1-14H,15H2/b22-13+ |
| InChIKey | LJUQRVWDEHQHIQ-LPYMAVHISA-N |
| XLogP | 1.91 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|