C28H33N7O3S — CID 118719442
(1R,2S,5R)-3-[[5-(1,3-benzothiazol-2-yl)-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 118719442) has the molecular formula C28H33N7O3S and a molecular weight of 547.69 g/mol. Its IUPAC name is (1R,2S,5R)-3-[[5-(1,3-benzothiazol-2-yl)-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,5R)-3-[[5-(1,3-benzothiazol-2-yl)-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 118719442 |
| Molecular Formula | C28H33N7O3S |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | (1R,2S,5R)-3-[[5-(1,3-benzothiazol-2-yl)-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CN1CCN(c2cccc(Nc3ncc(-c4nc5ccccc5s4)c(NC4C[C@H](CO)[C@@H](O)[C@H]4O)n3)c2)CC1 |
| InChI | InChI=1S/C28H33N7O3S/c1-34-9-11-35(12-10-34)19-6-4-5-18(14-19)30-28-29-15-20(27-32-21-7-2-3-8-23(21)39-27)26(33-28)31-22-13-17(16-36)24(37)25(22)38/h2-8,14-15,17,22,24-25,36-38H,9-13,16H2,1H3,(H2,29,30,31,33)/t17-,22?,24-,25+/m1/s1 |
| InChIKey | DENXHBFRECRKIO-KADIMKPJSA-N |
| XLogP | 2.76 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |