C26H28N6O4S — CID 137440335
methyl (1R,2R,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-[(2,6-dimethyl-4-pyridinyl)amino]pyrimidin-4-yl]amino]-2-hydroxy-3-methoxycyclopentane-1-carboxylate (PubChem CID 137440335) has the molecular formula C26H28N6O4S and a molecular weight of 520.62 g/mol. Its IUPAC name is methyl (1R,2R,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-[(2,6-dimethyl-4-pyridinyl)amino]pyrimidin-4-yl]amino]-2-hydroxy-3-methoxycyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-[(2,6-dimethyl-4-pyridinyl)amino]pyrimidin-4-yl]amino]-2-hydroxy-3-methoxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 137440335 |
| Molecular Formula | C26H28N6O4S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | methyl (1R,2R,3R,4R)-4-[[5-(1,3-benzothiazol-2-yl)-2-[(2,6-dimethyl-4-pyridinyl)amino]pyrimidin-4-yl]amino]-2-hydroxy-3-methoxycyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](Nc2nc(Nc3cc(C)nc(C)c3)ncc2-c2nc3ccccc3s2)[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C26H28N6O4S/c1-13-9-15(10-14(2)28-13)29-26-27-12-17(24-31-18-7-5-6-8-20(18)37-24)23(32-26)30-19-11-16(25(34)36-4)21(33)22(19)35-3/h5-10,12,16,19,21-22,33H,11H2,1-4H3,(H2,27,28,29,30,32)/t16-,19-,21-,22-/m1/s1 |
| InChIKey | HJYODLMYFLERCO-JCXROGDPSA-N |
| XLogP | 3.86 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |