C22H25F3N6O3S — CID 77447004
4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide (PubChem CID 77447004) has the molecular formula C22H25F3N6O3S and a molecular weight of 510.54 g/mol. Its IUPAC name is 4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide.
| Compound Name | 4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 77447004 |
| Molecular Formula | C22H25F3N6O3S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-N-ethyl-2,3-dihydroxycyclopentane-1-carboxamide |
| SMILES | CCNC(=O)C1CC(Nc2nc(NCC(F)(F)F)nc(C)c2-c2nc3ccccc3s2)C(O)C1O |
| InChI | InChI=1S/C22H25F3N6O3S/c1-3-26-19(34)11-8-13(17(33)16(11)32)29-18-15(20-30-12-6-4-5-7-14(12)35-20)10(2)28-21(31-18)27-9-22(23,24)25/h4-7,11,13,16-17,32-33H,3,8-9H2,1-2H3,(H,26,34)(H2,27,28,29,31) |
| InChIKey | UDEHMGYHYLEQBJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |