C24H29F3N6O3S — CID 58570228
(1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(morpholin-4-ylmethyl)cyclopentane-1,2-diol (PubChem CID 58570228) has the molecular formula C24H29F3N6O3S and a molecular weight of 538.60 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(morpholin-4-ylmethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(morpholin-4-ylmethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570228 |
| Molecular Formula | C24H29F3N6O3S |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(morpholin-4-ylmethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@@H]2C[C@H](CN3CCOCC3)[C@@H](O)[C@H]2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H29F3N6O3S/c1-13-18(22-31-15-4-2-3-5-17(15)37-22)21(32-23(29-13)28-12-24(25,26)27)30-16-10-14(19(34)20(16)35)11-33-6-8-36-9-7-33/h2-5,14,16,19-20,34-35H,6-12H2,1H3,(H2,28,29,30,32)/t14-,16-,19-,20+/m1/s1 |
| InChIKey | QEVAPGAMGCWZHR-FCNFAXOHSA-N |
| XLogP | 2.89 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |