C25H31F3N6O4S — CID 76833509
[4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl 2-amino-3-methylbutanoate (PubChem CID 76833509) has the molecular formula C25H31F3N6O4S and a molecular weight of 568.62 g/mol. Its IUPAC name is [4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl 2-amino-3-methylbutanoate.
| Compound Name | [4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 76833509 |
| Molecular Formula | C25H31F3N6O4S |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | [4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl 2-amino-3-methylbutanoate |
| SMILES | Cc1nc(NCC(F)(F)F)nc(NC2CC(COC(=O)C(N)C(C)C)C(O)C2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H31F3N6O4S/c1-11(2)18(29)23(37)38-9-13-8-15(20(36)19(13)35)32-21-17(22-33-14-6-4-5-7-16(14)39-22)12(3)31-24(34-21)30-10-25(26,27)28/h4-7,11,13,15,18-20,35-36H,8-10,29H2,1-3H3,(H2,30,31,32,34) |
| InChIKey | POEMTDDYRZRVFC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |