C23H28F3N5O2S — CID 70919451
(1S,2S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxy-2-methylpropyl)cyclopentan-1-ol (PubChem CID 70919451) has the molecular formula C23H28F3N5O2S and a molecular weight of 495.57 g/mol. Its IUPAC name is (1S,2S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxy-2-methylpropyl)cyclopentan-1-ol.
| Compound Name | (1S,2S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxy-2-methylpropyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 70919451 |
| Molecular Formula | C23H28F3N5O2S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (1S,2S,4R)-4-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2-(1-hydroxy-2-methylpropyl)cyclopentan-1-ol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@@H]2C[C@H](C(O)C(C)C)[C@@H](O)C2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H28F3N5O2S/c1-11(2)19(33)14-8-13(9-16(14)32)29-20-18(21-30-15-6-4-5-7-17(15)34-21)12(3)28-22(31-20)27-10-23(24,25)26/h4-7,11,13-14,16,19,32-33H,8-10H2,1-3H3,(H2,27,28,29,31)/t13-,14+,16+,19?/m1/s1 |
| InChIKey | RTLCPIUVFJBYPH-UBANZZBXSA-N |
| XLogP | 4.60 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |